C23H18ClFN4O4 — CID 126205062
(5E)-3-benzyl-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126205062) has the molecular formula C23H18ClFN4O4 and a molecular weight of 468.87 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126205062 |
| Molecular Formula | C23H18ClFN4O4 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (5E)-3-benzyl-5-[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)ccc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C23H18ClFN4O4/c1-2-32-19-11-15(8-9-18(19)33-20-16(25)12-26-22(24)28-20)10-17-21(30)29(23(31)27-17)13-14-6-4-3-5-7-14/h3-12H,2,13H2,1H3,(H,27,31)/b17-10+ |
| InChIKey | FVNFZXBFRWIACN-LICLKQGHSA-N |
| XLogP | 4.55 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|