C24H20BrN3O5S — CID 1232068
2-[[4-bromo-2-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 1232068) has the molecular formula C24H20BrN3O5S and a molecular weight of 542.41 g/mol. Its IUPAC name is 2-[[4-bromo-2-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-bromo-2-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 1232068 |
| Molecular Formula | C24H20BrN3O5S |
| Molecular Weight | 542.41 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | 2-[[4-bromo-2-[(E)-[3-(2-morpholin-4-yl-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(Br)cc1/C=C1/SC(=O)N(CC(=O)N2CCOCC2)C1=O |
| InChI | InChI=1S/C24H20BrN3O5S/c25-19-5-6-20(33-15-17-4-2-1-3-16(17)13-26)18(11-19)12-21-23(30)28(24(31)34-21)14-22(29)27-7-9-32-10-8-27/h1-6,11-12H,7-10,14-15H2/b21-12+ |
| InChIKey | JUHWXZAXOFWDLT-CIAFOILYSA-N |
| XLogP | 3.79 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|