C26H19BrN2O3S — CID 126013368
2-[[4-bromo-2-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126013368) has the molecular formula C26H19BrN2O3S and a molecular weight of 519.42 g/mol. Its IUPAC name is 2-[[4-bromo-2-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-bromo-2-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126013368 |
| Molecular Formula | C26H19BrN2O3S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | 2-[[4-bromo-2-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(Br)cc1/C=C1\SC(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H19BrN2O3S/c27-22-10-11-23(32-17-20-9-5-4-8-19(20)16-28)21(14-22)15-24-25(30)29(26(31)33-24)13-12-18-6-2-1-3-7-18/h1-11,14-15H,12-13,17H2/b24-15- |
| InChIKey | LKBIKXVNCKEKDN-IWIPYMOSSA-N |
| XLogP | 6.18 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|