C30H26N2O4S — CID 126012222
2-[[4-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile (PubChem CID 126012222) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is 2-[[4-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126012222 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 2-[[4-[(Z)-[2,4-dioxo-3-(2-phenylethyl)-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-prop-2-enylphenoxy]methyl]benzonitrile |
| SMILES | C=CCc1cc(/C=C2\SC(=O)N(CCc3ccccc3)C2=O)cc(OC)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C30H26N2O4S/c1-3-9-23-16-22(17-26(35-2)28(23)36-20-25-13-8-7-12-24(25)19-31)18-27-29(33)32(30(34)37-27)15-14-21-10-5-4-6-11-21/h3-8,10-13,16-18H,1,9,14-15,20H2,2H3/b27-18- |
| InChIKey | GIMIUIQUJSBRCJ-IMRQLAEWSA-N |
| XLogP | 6.15 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|