C26H18BrClN2O4S — CID 124663504
4-[[2-bromo-4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 124663504) has the molecular formula C26H18BrClN2O4S and a molecular weight of 569.86 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2-bromo-4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124663504 |
| Molecular Formula | C26H18BrClN2O4S |
| Molecular Weight | 569.86 g/mol |
| Exact Mass | 567.99 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3ccccc3Cl)C2=O)cc(Br)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H18BrClN2O4S/c1-33-22-11-18(10-20(27)24(22)34-15-17-8-6-16(13-29)7-9-17)12-23-25(31)30(26(32)35-23)14-19-4-2-3-5-21(19)28/h2-12H,14-15H2,1H3/b23-12+ |
| InChIKey | AMQYDQWEWZCHPD-FSJBWODESA-N |
| XLogP | 6.80 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.86 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|