C20H15Cl2FN2O4S — CID 126240203
2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126240203) has the molecular formula C20H15Cl2FN2O4S and a molecular weight of 469.32 g/mol. Its IUPAC name is 2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126240203 |
| Molecular Formula | C20H15Cl2FN2O4S |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | CCOc1c(Cl)cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C20H15Cl2FN2O4S/c1-2-29-18-14(21)6-11(7-15(18)22)8-16-19(27)25(20(28)30-16)10-17(26)24-13-5-3-4-12(23)9-13/h3-9H,2,10H2,1H3,(H,24,26)/b16-8+ |
| InChIKey | XSAVCHYARBFYCE-LZYBPNLTSA-N |
| XLogP | 5.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|