C25H25FN2O5S — CID 126241545
2-[(5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 126241545) has the molecular formula C25H25FN2O5S and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-[(5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126241545 |
| Molecular Formula | C25H25FN2O5S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-[(5E)-5-[(3,4-diethoxy-5-prop-2-enylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | C=CCc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H25FN2O5S/c1-4-8-17-11-16(12-20(32-5-2)23(17)33-6-3)13-21-24(30)28(25(31)34-21)15-22(29)27-19-10-7-9-18(26)14-19/h4,7,9-14H,1,5-6,8,15H2,2-3H3,(H,27,29)/b21-13+ |
| InChIKey | ZVWSDPLIGRMWFF-FYJGNVAPSA-N |
| XLogP | 5.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|