C14H11Cl2NO5S — CID 126136059
2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126136059) has the molecular formula C14H11Cl2NO5S and a molecular weight of 376.22 g/mol. Its IUPAC name is 2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126136059 |
| Molecular Formula | C14H11Cl2NO5S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2-[(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCOc1c(Cl)cc(/C=C2/SC(=O)N(CC(=O)O)C2=O)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO5S/c1-2-22-12-8(15)3-7(4-9(12)16)5-10-13(20)17(6-11(18)19)14(21)23-10/h3-5H,2,6H2,1H3,(H,18,19)/b10-5+ |
| InChIKey | MBHCYOSXACWLLN-BJMVGYQFSA-N |
| XLogP | 3.51 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|