C15H13Cl2NO6S — CID 126150499
2-[2,6-dichloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126150499) has the molecular formula C15H13Cl2NO6S and a molecular weight of 406.24 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126150499 |
| Molecular Formula | C15H13Cl2NO6S |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-[2,6-dichloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COCCN1C(=O)S/C(=C/c2cc(Cl)c(OCC(=O)O)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H13Cl2NO6S/c1-23-3-2-18-14(21)11(25-15(18)22)6-8-4-9(16)13(10(17)5-8)24-7-12(19)20/h4-6H,2-3,7H2,1H3,(H,19,20)/b11-6+ |
| InChIKey | DWKYAUIAMNIKRD-IZZDOVSWSA-N |
| XLogP | 3.14 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|