C16H15BrClNO6S — CID 126143857
methyl 2-[2-bromo-6-chloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126143857) has the molecular formula C16H15BrClNO6S and a molecular weight of 464.72 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-chloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-chloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126143857 |
| Molecular Formula | C16H15BrClNO6S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | methyl 2-[2-bromo-6-chloro-4-[(E)-[3-(2-methoxyethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | COCCN1C(=O)S/C(=C/c2cc(Cl)c(OCC(=O)OC)c(Br)c2)C1=O |
| InChI | InChI=1S/C16H15BrClNO6S/c1-23-4-3-19-15(21)12(26-16(19)22)7-9-5-10(17)14(11(18)6-9)25-8-13(20)24-2/h5-7H,3-4,8H2,1-2H3/b12-7+ |
| InChIKey | VXMKBTBJSTUPLE-KPKJPENVSA-N |
| XLogP | 3.34 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|