C25H16Br2ClN3O6S — CID 126244593
N-(2-chlorophenyl)-2-[(5E)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126244593) has the molecular formula C25H16Br2ClN3O6S and a molecular weight of 681.75 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(5E)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(5E)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126244593 |
| Molecular Formula | C25H16Br2ClN3O6S |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 678.88 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(5E)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(Br)c(OCc3cccc([N+](=O)[O-])c3)c(Br)c2)C1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H16Br2ClN3O6S/c26-17-9-15(10-18(27)23(17)37-13-14-4-3-5-16(8-14)31(35)36)11-21-24(33)30(25(34)38-21)12-22(32)29-20-7-2-1-6-19(20)28/h1-11H,12-13H2,(H,29,32)/b21-11+ |
| InChIKey | ZOGWUMHBMRQFQP-SRZZPIQSSA-N |
| XLogP | 7.03 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|