C31H30BrN3O5S — CID 126020480
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126020480) has the molecular formula C31H30BrN3O5S and a molecular weight of 636.57 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126020480 |
| Molecular Formula | C31H30BrN3O5S |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 635.11 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCN(c4ccccc4)CC3)C2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C31H30BrN3O5S/c1-2-39-27-18-23(10-13-26(27)40-21-22-8-11-24(32)12-9-22)19-28-30(37)35(31(38)41-28)20-29(36)34-16-14-33(15-17-34)25-6-4-3-5-7-25/h3-13,18-19H,2,14-17,20-21H2,1H3/b28-19+ |
| InChIKey | OEMSMTHPMDGVBX-TURZUDJPSA-N |
| XLogP | 5.81 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|