C21H21ClN2O4S — CID 126205244
(5Z)-3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126205244) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is (5Z)-3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126205244 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (5Z)-3-[2-(azepan-1-yl)-2-oxoethyl]-5-[(5-chloro-2-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCOc1ccc(Cl)cc1/C=C1\SC(=O)N(CC(=O)N2CCCCCC2)C1=O |
| InChI | InChI=1S/C21H21ClN2O4S/c1-2-11-28-17-8-7-16(22)12-15(17)13-18-20(26)24(21(27)29-18)14-19(25)23-9-5-3-4-6-10-23/h1,7-8,12-13H,3-6,9-11,14H2/b18-13- |
| InChIKey | AQHXAYCCGREZDO-AQTBWJFISA-N |
| XLogP | 3.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|