C26H26BrN3O7S — CID 126385009
(5Z)-5-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126385009) has the molecular formula C26H26BrN3O7S and a molecular weight of 604.48 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126385009 |
| Molecular Formula | C26H26BrN3O7S |
| Molecular Weight | 604.48 g/mol |
| Exact Mass | 603.07 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)N3CCCCC3)C2=O)cc(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26BrN3O7S/c1-2-36-21-13-18(12-20(27)24(21)37-16-17-7-6-8-19(11-17)30(34)35)14-22-25(32)29(26(33)38-22)15-23(31)28-9-4-3-5-10-28/h6-8,11-14H,2-5,9-10,15-16H2,1H3/b22-14- |
| InChIKey | MXTBQMFMATVCAN-HMAPJEAMSA-N |
| XLogP | 5.38 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|