C18H15BrClNO2 — CID 6041304
(E)-3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile (PubChem CID 6041304) has the molecular formula C18H15BrClNO2 and a molecular weight of 392.68 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6041304 |
| Molecular Formula | C18H15BrClNO2 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | (E)-3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C/C#N)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15BrClNO2/c1-2-22-17-11-13(6-4-8-21)10-16(19)18(17)23-12-14-5-3-7-15(20)9-14/h3-7,9-11H,2,12H2,1H3/b6-4+ |
| InChIKey | QQYBLVZPSQDHIO-GQCTYLIASA-N |
| XLogP | 5.62 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|