C25H19Cl2NO — CID 126217246
N-(3-chloro-2-methylphenyl)-1-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methanimine (PubChem CID 126217246) has the molecular formula C25H19Cl2NO and a molecular weight of 420.34 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-1-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methanimine.
| Compound Name | N-(3-chloro-2-methylphenyl)-1-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 126217246 |
| Molecular Formula | C25H19Cl2NO |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-1-[3-chloro-4-(naphthalen-1-ylmethoxy)phenyl]methanimine |
| SMILES | Cc1c(Cl)cccc1/N=C/c1ccc(OCc2cccc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl2NO/c1-17-22(26)10-5-11-24(17)28-15-18-12-13-25(23(27)14-18)29-16-20-8-4-7-19-6-2-3-9-21(19)20/h2-15H,16H2,1H3/b28-15+ |
| InChIKey | LXNVZTBZCGQUOA-RWPZCVJISA-N |
| XLogP | 7.78 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|