C24H17Br2N3O — CID 126379362
(Z)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 126379362) has the molecular formula C24H17Br2N3O and a molecular weight of 523.23 g/mol. Its IUPAC name is (Z)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126379362 |
| Molecular Formula | C24H17Br2N3O |
| Molecular Weight | 523.23 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | (Z)-3-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3cc(Br)ccc3OCc3ccc(Br)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H17Br2N3O/c1-15-2-8-21-22(10-15)29-24(28-21)18(13-27)11-17-12-20(26)7-9-23(17)30-14-16-3-5-19(25)6-4-16/h2-12H,14H2,1H3,(H,28,29)/b18-11- |
| InChIKey | YVDKYIVGTQUGHV-WQRHYEAKSA-N |
| XLogP | 7.04 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.23 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|