C25H16I2N4O — CID 126375750
2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]methyl]benzonitrile (PubChem CID 126375750) has the molecular formula C25H16I2N4O and a molecular weight of 642.24 g/mol. Its IUPAC name is 2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126375750 |
| Molecular Formula | C25H16I2N4O |
| Molecular Weight | 642.24 g/mol |
| Exact Mass | 641.94 |
| IUPAC Name | 2-[[4-[(Z)-2-cyano-2-(6-methyl-1H-benzimidazol-2-yl)ethenyl]-2,6-diiodophenoxy]methyl]benzonitrile |
| SMILES | Cc1ccc2nc(/C(C#N)=C\c3cc(I)c(OCc4ccccc4C#N)c(I)c3)[nH]c2c1 |
| InChI | InChI=1S/C25H16I2N4O/c1-15-6-7-22-23(8-15)31-25(30-22)19(13-29)9-16-10-20(26)24(21(27)11-16)32-14-18-5-3-2-4-17(18)12-28/h2-11H,14H2,1H3,(H,30,31)/b19-9- |
| InChIKey | BAJOURSAAZQNJJ-OCKHKDLRSA-N |
| XLogP | 6.60 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.24 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|