C24H17N3O3 — CID 126054298
5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-phenylmethoxybenzoic acid (PubChem CID 126054298) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-phenylmethoxybenzoic acid.
| Compound Name | 5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 126054298 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 5-[(Z)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-phenylmethoxybenzoic acid |
| SMILES | N#C/C(=C/c1ccc(OCc2ccccc2)c(C(=O)O)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H17N3O3/c25-14-18(23-26-20-8-4-5-9-21(20)27-23)12-17-10-11-22(19(13-17)24(28)29)30-15-16-6-2-1-3-7-16/h1-13H,15H2,(H,26,27)(H,28,29)/b18-12- |
| InChIKey | NOVYQGYMNFVKSU-PDGQHHTCSA-N |
| XLogP | 4.90 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|