C27H23BrClN3O4 — CID 126262244
(E)-3-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126262244) has the molecular formula C27H23BrClN3O4 and a molecular weight of 568.86 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126262244 |
| Molecular Formula | C27H23BrClN3O4 |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | (E)-3-[3-bromo-4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2ccc(OCC(=O)Nc3ccc(C)c(Cl)c3)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H23BrClN3O4/c1-3-35-22-9-7-20(8-10-22)32-27(34)19(15-30)12-18-5-11-25(23(28)13-18)36-16-26(33)31-21-6-4-17(2)24(29)14-21/h4-14H,3,16H2,1-2H3,(H,31,33)(H,32,34)/b19-12+ |
| InChIKey | JOEYISLRHHXNQA-XDHOZWIPSA-N |
| XLogP | 6.37 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|