C28H24ClN3O5 — CID 126262485
methyl 4-[[(Z)-3-[5-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 126262485) has the molecular formula C28H24ClN3O5 and a molecular weight of 517.97 g/mol. Its IUPAC name is methyl 4-[[(Z)-3-[5-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-3-[5-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126262485 |
| Molecular Formula | C28H24ClN3O5 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | methyl 4-[[(Z)-3-[5-chloro-2-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cc(Cl)ccc2OCC(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C28H24ClN3O5/c1-17-4-8-24(12-18(17)2)31-26(33)16-37-25-11-7-22(29)14-20(25)13-21(15-30)27(34)32-23-9-5-19(6-10-23)28(35)36-3/h4-14H,16H2,1-3H3,(H,31,33)(H,32,34)/b21-13- |
| InChIKey | NMZBXJSMMUISOZ-BKUYFWCQSA-N |
| XLogP | 5.31 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|