C26H22ClN3O4 — CID 126380789
(Z)-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide (PubChem CID 126380789) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is (Z)-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126380789 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (Z)-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(Cl)cc1/C=C(/C#N)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H22ClN3O4/c1-17-7-10-21(11-8-17)29-26(32)19(15-28)13-18-14-20(27)9-12-23(18)34-16-25(31)30-22-5-3-4-6-24(22)33-2/h3-14H,16H2,1-2H3,(H,29,32)(H,30,31)/b19-13- |
| InChIKey | VXLHSZIGHNMRRK-UYRXBGFRSA-N |
| XLogP | 5.22 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|