C26H22ClN3O4 — CID 126376176
(E)-N-benzyl-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enamide (PubChem CID 126376176) has the molecular formula C26H22ClN3O4 and a molecular weight of 475.93 g/mol. Its IUPAC name is (E)-N-benzyl-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-benzyl-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126376176 |
| Molecular Formula | C26H22ClN3O4 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | (E)-N-benzyl-3-[5-chloro-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyanoprop-2-enamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(Cl)cc1/C=C(\C#N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H22ClN3O4/c1-33-24-10-6-5-9-22(24)30-25(31)17-34-23-12-11-21(27)14-19(23)13-20(15-28)26(32)29-16-18-7-3-2-4-8-18/h2-14H,16-17H2,1H3,(H,29,32)(H,30,31)/b20-13+ |
| InChIKey | XAMUGFTXYKUBEW-DEDYPNTBSA-N |
| XLogP | 4.59 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|