C29H27N3O7 — CID 126383416
methyl 4-[[(Z)-2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126383416) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126383416 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccc(C(=O)OC)cc2)ccc1OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H27N3O7/c1-4-38-26-16-19(5-14-25(26)39-18-27(33)31-22-10-12-24(36-2)13-11-22)15-21(17-30)28(34)32-23-8-6-20(7-9-23)29(35)37-3/h5-16H,4,18H2,1-3H3,(H,31,33)(H,32,34)/b21-15- |
| InChIKey | SFDZNJOUGMHBTA-QNGOZBTKSA-N |
| XLogP | 4.44 |
| TPSA | 135.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|