C28H27N3O5 — CID 5124063
2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide (PubChem CID 5124063) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5124063 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-cyano-3-[3-ethoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-N-(3-methylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2cccc(C)c2)ccc1OCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H27N3O5/c1-4-35-26-16-20(15-21(17-29)28(33)31-23-7-5-6-19(2)14-23)8-13-25(26)36-18-27(32)30-22-9-11-24(34-3)12-10-22/h5-16H,4,18H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | JPYZIYJVOFOWFY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|