C28H34N2O5 — CID 124555045
methyl 4-[[(Z)-2-cyano-3-(3-ethoxy-4-octoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 124555045) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-(3-ethoxy-4-octoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-(3-ethoxy-4-octoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 124555045 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-(3-ethoxy-4-octoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCCCCCOc1ccc(/C=C(/C#N)C(=O)Nc2ccc(C(=O)OC)cc2)cc1OCC |
| InChI | InChI=1S/C28H34N2O5/c1-4-6-7-8-9-10-17-35-25-16-11-21(19-26(25)34-5-2)18-23(20-29)27(31)30-24-14-12-22(13-15-24)28(32)33-3/h11-16,18-19H,4-10,17H2,1-3H3,(H,30,31)/b23-18- |
| InChIKey | JTUZCGNQBKSQJK-NKFKGCMQSA-N |
| XLogP | 6.16 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|