C20H21N3O2 — CID 6046683
(2Z)-3-(2-aminoanilino)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile (PubChem CID 6046683) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (2Z)-3-(2-aminoanilino)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile.
| Compound Name | (2Z)-3-(2-aminoanilino)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile |
|---|---|
| PubChem CID | 6046683 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (2Z)-3-(2-aminoanilino)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile |
| SMILES | C=C(Nc1ccccc1N)/C(C#N)=C/c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-4-25-19-10-9-15(12-20(19)24-3)11-16(13-21)14(2)23-18-8-6-5-7-17(18)22/h5-12,23H,2,4,22H2,1,3H3/b16-11+ |
| InChIKey | LSKNZCVOVRXRBL-LFIBNONCSA-N |
| XLogP | 4.21 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|