C27H26ClN3O2 — CID 126341349
(2Z)-3-[2-amino-N-[(4-chlorophenyl)methyl]anilino]-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile (PubChem CID 126341349) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is (2Z)-3-[2-amino-N-[(4-chlorophenyl)methyl]anilino]-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile.
| Compound Name | (2Z)-3-[2-amino-N-[(4-chlorophenyl)methyl]anilino]-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile |
|---|---|
| PubChem CID | 126341349 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (2Z)-3-[2-amino-N-[(4-chlorophenyl)methyl]anilino]-2-[(4-ethoxy-3-methoxyphenyl)methylidene]but-3-enenitrile |
| SMILES | C=C(/C(C#N)=C/c1ccc(OCC)c(OC)c1)N(Cc1ccc(Cl)cc1)c1ccccc1N |
| InChI | InChI=1S/C27H26ClN3O2/c1-4-33-26-14-11-21(16-27(26)32-3)15-22(17-29)19(2)31(25-8-6-5-7-24(25)30)18-20-9-12-23(28)13-10-20/h5-16H,2,4,18,30H2,1,3H3/b22-15+ |
| InChIKey | OZSOQIQTJPBFPK-PXLXIMEGSA-N |
| XLogP | 6.46 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|