C28H26BrN3O5 — CID 126387227
(Z)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 126387227) has the molecular formula C28H26BrN3O5 and a molecular weight of 564.44 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126387227 |
| Molecular Formula | C28H26BrN3O5 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (Z)-3-[3-bromo-5-methoxy-4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)COc2c(Br)cc(/C=C(/C#N)C(=O)Nc3cccc(C)c3C)cc2OC)cc1 |
| InChI | InChI=1S/C28H26BrN3O5/c1-17-6-5-7-24(18(17)2)32-28(34)20(15-30)12-19-13-23(29)27(25(14-19)36-4)37-16-26(33)31-21-8-10-22(35-3)11-9-21/h5-14H,16H2,1-4H3,(H,31,33)(H,32,34)/b20-12- |
| InChIKey | MVLIOTLFOHDMCZ-NDENLUEZSA-N |
| XLogP | 5.65 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|