C26H19BrF3N3O5 — CID 126244699
(Z)-3-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126244699) has the molecular formula C26H19BrF3N3O5 and a molecular weight of 590.35 g/mol. Its IUPAC name is (Z)-3-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126244699 |
| Molecular Formula | C26H19BrF3N3O5 |
| Molecular Weight | 590.35 g/mol |
| Exact Mass | 589.05 |
| IUPAC Name | (Z)-3-[2-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(C(F)(F)F)c2)c(Br)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H19BrF3N3O5/c1-2-37-23-11-17(22(27)13-24(23)38-15-16-6-8-21(9-7-16)33(35)36)10-18(14-31)25(34)32-20-5-3-4-19(12-20)26(28,29)30/h3-13H,2,15H2,1H3,(H,32,34)/b18-10- |
| InChIKey | KTURXYBDPFPGMC-ZDLGFXPLSA-N |
| XLogP | 6.90 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.35 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|