C20H17BrFN3O4 — CID 126236172
(Z)-3-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide (PubChem CID 126236172) has the molecular formula C20H17BrFN3O4 and a molecular weight of 462.28 g/mol. Its IUPAC name is (Z)-3-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126236172 |
| Molecular Formula | C20H17BrFN3O4 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | (Z)-3-[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC(N)=O)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H17BrFN3O4/c1-2-28-17-8-13(7-14(10-23)19(26)25-20(24)27)16(21)9-18(17)29-11-12-3-5-15(22)6-4-12/h3-9H,2,11H2,1H3,(H3,24,25,26,27)/b14-7- |
| InChIKey | WHUMCSNVZIVICW-AUWJEWJLSA-N |
| XLogP | 3.67 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|