C16H16BrN3O6 — CID 126259894
methyl 2-[5-bromo-4-[(Z)-3-(carbamoylamino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate (PubChem CID 126259894) has the molecular formula C16H16BrN3O6 and a molecular weight of 426.22 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(Z)-3-(carbamoylamino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(Z)-3-(carbamoylamino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126259894 |
| Molecular Formula | C16H16BrN3O6 |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | methyl 2-[5-bromo-4-[(Z)-3-(carbamoylamino)-2-cyano-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC(N)=O)c(Br)cc1OCC(=O)OC |
| InChI | InChI=1S/C16H16BrN3O6/c1-3-25-12-5-9(4-10(7-18)15(22)20-16(19)23)11(17)6-13(12)26-8-14(21)24-2/h4-6H,3,8H2,1-2H3,(H3,19,20,22,23)/b10-4- |
| InChIKey | VBCZVIUAXUTJLS-WMZJFQQLSA-N |
| XLogP | 1.50 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|