C20H23BrN2O5 — CID 126195145
ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate (PubChem CID 126195145) has the molecular formula C20H23BrN2O5 and a molecular weight of 451.32 g/mol. Its IUPAC name is ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126195145 |
| Molecular Formula | C20H23BrN2O5 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=C(/C#N)C(=O)NC2CCCC2)cc1OC |
| InChI | InChI=1S/C20H23BrN2O5/c1-3-27-19(24)12-28-18-10-16(21)13(9-17(18)26-2)8-14(11-22)20(25)23-15-6-4-5-7-15/h8-10,15H,3-7,12H2,1-2H3,(H,23,25)/b14-8- |
| InChIKey | BXMCUVUZXKCYJQ-ZSOIEALJSA-N |
| XLogP | 3.37 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|