C18H15FIN3O — CID 108860210
(Z)-2-cyano-3-[(2-fluorophenyl)methylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide (PubChem CID 108860210) has the molecular formula C18H15FIN3O and a molecular weight of 435.24 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(2-fluorophenyl)methylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(2-fluorophenyl)methylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108860210 |
| Molecular Formula | C18H15FIN3O |
| Molecular Weight | 435.24 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | (Z)-2-cyano-3-[(2-fluorophenyl)methylamino]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
| SMILES | Cc1cc(I)ccc1NC(=O)/C(C#N)=C\NCc1ccccc1F |
| InChI | InChI=1S/C18H15FIN3O/c1-12-8-15(20)6-7-17(12)23-18(24)14(9-21)11-22-10-13-4-2-3-5-16(13)19/h2-8,11,22H,10H2,1H3,(H,23,24)/b14-11- |
| InChIKey | HLOWMCDLTUIFRV-KAMYIIQDSA-N |
| XLogP | 3.87 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|