C18H26N6O — CID 108863891
(Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108863891) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is (Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863891 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCc1cccc(CN)c1)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H26N6O/c19-11-15-2-1-3-16(10-15)13-22-14-17(12-20)18(25)23-6-9-24-7-4-21-5-8-24/h1-3,10,14,21-22H,4-9,11,13,19H2,(H,23,25)/b17-14- |
| InChIKey | GXMNBHINBGHZGI-VKAVYKQESA-N |
| XLogP | -0.34 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|