C18H25N5O2 — CID 108863021
(Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 108863021) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863021 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (Z)-3-[[3-(aminomethyl)phenyl]methylamino]-2-cyano-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCc1cccc(CN)c1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H25N5O2/c19-11-15-2-1-3-16(10-15)13-21-14-17(12-20)18(24)22-4-5-23-6-8-25-9-7-23/h1-3,10,14,21H,4-9,11,13,19H2,(H,22,24)/b17-14- |
| InChIKey | UXOJVAVYKVCBES-VKAVYKQESA-N |
| XLogP | 0.09 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|