C15H23N5O4S — CID 108517755
N-(2-piperazin-1-ylethyl)-N'-[(4-sulfamoylphenyl)methyl]oxamide (PubChem CID 108517755) has the molecular formula C15H23N5O4S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-N'-[(4-sulfamoylphenyl)methyl]oxamide.
| Compound Name | N-(2-piperazin-1-ylethyl)-N'-[(4-sulfamoylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108517755 |
| Molecular Formula | C15H23N5O4S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-N'-[(4-sulfamoylphenyl)methyl]oxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(=O)NCCN2CCNCC2)cc1 |
| InChI | InChI=1S/C15H23N5O4S/c16-25(23,24)13-3-1-12(2-4-13)11-19-15(22)14(21)18-7-10-20-8-5-17-6-9-20/h1-4,17H,5-11H2,(H,18,21)(H,19,22)(H2,16,23,24) |
| InChIKey | KBRKFQFOQLSGOC-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|