C16H24N4O2 — CID 108517726
N'-[(4-methylphenyl)methyl]-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517726) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-[(4-methylphenyl)methyl]-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-[(4-methylphenyl)methyl]-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517726 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N'-[(4-methylphenyl)methyl]-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)NCCN2CCNCC2)cc1 |
| InChI | InChI=1S/C16H24N4O2/c1-13-2-4-14(5-3-13)12-19-16(22)15(21)18-8-11-20-9-6-17-7-10-20/h2-5,17H,6-12H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | PKAVPCMYNIULKW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|