C16H20N4O3S — CID 108835542
(Z)-2-cyano-N-cyclopentyl-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide (PubChem CID 108835542) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108835542 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[(4-sulfamoylphenyl)methylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20N4O3S/c17-9-13(16(21)20-14-3-1-2-4-14)11-19-10-12-5-7-15(8-6-12)24(18,22)23/h5-8,11,14,19H,1-4,10H2,(H,20,21)(H2,18,22,23)/b13-11- |
| InChIKey | CREDLGYZYWKMBZ-QBFSEMIESA-N |
| XLogP | 0.89 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|