C18H15F3N4O3S — CID 108826261
(Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 108826261) has the molecular formula C18H15F3N4O3S and a molecular weight of 424.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108826261 |
| Molecular Formula | C18H15F3N4O3S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (Z)-2-cyano-3-[(4-sulfamoylphenyl)methylamino]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N4O3S/c19-18(20,21)14-2-1-3-15(8-14)25-17(26)13(9-22)11-24-10-12-4-6-16(7-5-12)29(23,27)28/h1-8,11,24H,10H2,(H,25,26)(H2,23,27,28)/b13-11- |
| InChIKey | HAMUZLWDFVQOJD-QBFSEMIESA-N |
| XLogP | 2.49 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|