C15H16BrN3O3 — CID 108846121
4-[[(Z)-3-[(4-bromophenyl)methylamino]-2-cyanoprop-2-enoyl]amino]butanoic acid (PubChem CID 108846121) has the molecular formula C15H16BrN3O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is 4-[[(Z)-3-[(4-bromophenyl)methylamino]-2-cyanoprop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-3-[(4-bromophenyl)methylamino]-2-cyanoprop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108846121 |
| Molecular Formula | C15H16BrN3O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-[[(Z)-3-[(4-bromophenyl)methylamino]-2-cyanoprop-2-enoyl]amino]butanoic acid |
| SMILES | N#C/C(=C/NCc1ccc(Br)cc1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H16BrN3O3/c16-13-5-3-11(4-6-13)9-18-10-12(8-17)15(22)19-7-1-2-14(20)21/h3-6,10,18H,1-2,7,9H2,(H,19,22)(H,20,21)/b12-10- |
| InChIKey | MQYJNPKRRPRMKN-BENRWUELSA-N |
| XLogP | 1.93 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|