C17H15ClN4O — CID 108842194
(Z)-3-(4-amino-2-chloroanilino)-N-benzyl-2-cyanoprop-2-enamide (PubChem CID 108842194) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is (Z)-3-(4-amino-2-chloroanilino)-N-benzyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2-chloroanilino)-N-benzyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108842194 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (Z)-3-(4-amino-2-chloroanilino)-N-benzyl-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(N)cc1Cl)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H15ClN4O/c18-15-8-14(20)6-7-16(15)21-11-13(9-19)17(23)22-10-12-4-2-1-3-5-12/h1-8,11,21H,10,20H2,(H,22,23)/b13-11- |
| InChIKey | FTBIUHBAQYNQRH-QBFSEMIESA-N |
| XLogP | 3.06 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|