C18H17ClN4O2 — CID 108829205
(Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide (PubChem CID 108829205) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is (Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108829205 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (Z)-3-(4-amino-2-chloroanilino)-2-cyano-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(N)cc1Cl)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H17ClN4O2/c19-16-9-14(21)3-6-17(16)23-11-13(10-20)18(25)22-8-7-12-1-4-15(24)5-2-12/h1-6,9,11,23-24H,7-8,21H2,(H,22,25)/b13-11- |
| InChIKey | BEBIFAYMRNXMFI-QBFSEMIESA-N |
| XLogP | 2.81 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|