C19H16N4O2 — CID 108829117
(Z)-2-cyano-3-(2-cyanoanilino)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide (PubChem CID 108829117) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-cyanoanilino)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-cyanoanilino)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108829117 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (Z)-2-cyano-3-(2-cyanoanilino)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1C#N)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H16N4O2/c20-11-15-3-1-2-4-18(15)23-13-16(12-21)19(25)22-10-9-14-5-7-17(24)8-6-14/h1-8,13,23-24H,9-10H2,(H,22,25)/b16-13- |
| InChIKey | WORNLGKVHAGZBG-SSZFMOIBSA-N |
| XLogP | 2.44 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|