C14H14BrN3O2 — CID 4667950
3-(3-bromoanilino)-N-butanoyl-2-cyanoprop-2-enamide (PubChem CID 4667950) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 3-(3-bromoanilino)-N-butanoyl-2-cyanoprop-2-enamide.
| Compound Name | 3-(3-bromoanilino)-N-butanoyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4667950 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 3-(3-bromoanilino)-N-butanoyl-2-cyanoprop-2-enamide |
| SMILES | CCCC(=O)NC(=O)C(C#N)=CNc1cccc(Br)c1 |
| InChI | InChI=1S/C14H14BrN3O2/c1-2-4-13(19)18-14(20)10(8-16)9-17-12-6-3-5-11(15)7-12/h3,5-7,9,17H,2,4H2,1H3,(H,18,19,20) |
| InChIKey | FWXGGGHCWWTZSI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|