C26H19ClN2O6S — CID 19225812
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 19225812) has the molecular formula C26H19ClN2O6S and a molecular weight of 522.97 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19225812 |
| Molecular Formula | C26H19ClN2O6S |
| Molecular Weight | 522.97 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]-2-methoxyphenyl] 3-chloro-5-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc2sc(C(=O)Oc3ccc(/C=C(\C#N)C(=O)NCc4ccco4)cc3OC)c(Cl)c2c1 |
| InChI | InChI=1S/C26H19ClN2O6S/c1-32-17-6-8-22-19(12-17)23(27)24(36-22)26(31)35-20-7-5-15(11-21(20)33-2)10-16(13-28)25(30)29-14-18-4-3-9-34-18/h3-12H,14H2,1-2H3,(H,29,30)/b16-10+ |
| InChIKey | CGSPMBCTGKABSY-MHWRWJLKSA-N |
| XLogP | 5.61 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|