C18H16ClNO3 — CID 18285384
(3-cyanophenyl) 4-(4-chloro-3-methylphenoxy)butanoate (PubChem CID 18285384) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is (3-cyanophenyl) 4-(4-chloro-3-methylphenoxy)butanoate.
| Compound Name | (3-cyanophenyl) 4-(4-chloro-3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 18285384 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (3-cyanophenyl) 4-(4-chloro-3-methylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)Oc2cccc(C#N)c2)ccc1Cl |
| InChI | InChI=1S/C18H16ClNO3/c1-13-10-15(7-8-17(13)19)22-9-3-6-18(21)23-16-5-2-4-14(11-16)12-20/h2,4-5,7-8,10-11H,3,6,9H2,1H3 |
| InChIKey | QFNYQEKGAQEJCC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|