C15H12BrClN2O4 — CID 1185944
2-(2-bromo-4-methylphenoxy)-N-(4-chloro-3-nitrophenyl)acetamide (PubChem CID 1185944) has the molecular formula C15H12BrClN2O4 and a molecular weight of 399.63 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-(4-chloro-3-nitrophenyl)acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-(4-chloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1185944 |
| Molecular Formula | C15H12BrClN2O4 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-(4-chloro-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c(Br)c1 |
| InChI | InChI=1S/C15H12BrClN2O4/c1-9-2-5-14(11(16)6-9)23-8-15(20)18-10-3-4-12(17)13(7-10)19(21)22/h2-7H,8H2,1H3,(H,18,20) |
| InChIKey | XWFZDAWVJCLUQZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|