About 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide
2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide (PubChem CID 120790520) has the molecular formula C18H28N2O5
and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide |
| PubChem CID | 120790520 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide |
| SMILES | CCOc1c(OC)cc(CNC(=O)C(N)C2CCOCC2)cc1OC |
| InChI | InChI=1S/C18H28N2O5/c1-4-25-17-14(22-2)9-12(10-15(17)23-3)11-20-18(21)16(19)13-5-7-24-8-6-13/h9-10,13,16H,4-8,11,19H2,1-3H3,(H,20,21) |
| InChIKey | BKPGSYZIGHMQNE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide?
The IUPAC name of 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide (CID 120790520) is 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide.
What is the SMILES notation for 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide?
The canonical SMILES for 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide is CCOc1c(OC)cc(CNC(=O)C(N)C2CCOCC2)cc1OC.
What is the InChIKey of 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide?
The InChIKey is BKPGSYZIGHMQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O5/c1-4-25-17-14(22-2)9-12(10-15(17)23-3)11-20-18(21)16(19)13-5-7-24-8-6-13/h9-10,13,16H,4-8,11,19H2,1-3H3,(H,20,21).
What are the key properties of 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide?
2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide has a molecular weight of 352.43 g/mol, XLogP of 1.47, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-2-(oxan-4-yl)acetamide is sourced from PubChem (CID 120790520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).