C17H24N2O5 — CID 120793432
methyl 2-[3-[[[2-amino-2-(oxan-4-yl)acetyl]amino]methyl]phenoxy]acetate (PubChem CID 120793432) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 2-[3-[[[2-amino-2-(oxan-4-yl)acetyl]amino]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[[2-amino-2-(oxan-4-yl)acetyl]amino]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 120793432 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 2-[3-[[[2-amino-2-(oxan-4-yl)acetyl]amino]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(CNC(=O)C(N)C2CCOCC2)c1 |
| InChI | InChI=1S/C17H24N2O5/c1-22-15(20)11-24-14-4-2-3-12(9-14)10-19-17(21)16(18)13-5-7-23-8-6-13/h2-4,9,13,16H,5-8,10-11,18H2,1H3,(H,19,21) |
| InChIKey | MJDIGKTWXJZLIH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |